SJ000063181 structure
|
Common Name | SJ000063181 | ||
|---|---|---|---|---|
| CAS Number | 945189-68-4 | Molecular Weight | 296.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14ClFN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SJ000063181SJ000063181 is a potent BMP signaling activator with an EC50 ≤1 µM. SJ000063181 can be used as chemical probes to interrogate BMP signaling due to it can penetrate zebrafish embryos[1]. |
| Name | SJ000063181 |
|---|
| Description | SJ000063181 is a potent BMP signaling activator with an EC50 ≤1 µM. SJ000063181 can be used as chemical probes to interrogate BMP signaling due to it can penetrate zebrafish embryos[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H14ClFN2O2 |
|---|---|
| Molecular Weight | 296.72 |
| InChIKey | PBZNVOPQXYXTPC-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1cc(C(=O)Nc2ccc(F)c(Cl)c2)no1 |