2H-1-Benzopyran-6-ol,3,4-dihydro-2,2,5,7,8-pentamethyl structure
|
Common Name | 2H-1-Benzopyran-6-ol,3,4-dihydro-2,2,5,7,8-pentamethyl | ||
|---|---|---|---|---|
| CAS Number | 950-99-2 | Molecular Weight | 220.30700 | |
| Density | 1.034g/cm3 | Boiling Point | 344.3ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | 89-91ºC(lit.) | |
| MSDS | N/A | Flash Point | 146.1ºC | |
Use of 2H-1-Benzopyran-6-ol,3,4-dihydro-2,2,5,7,8-pentamethyl2,2,5,7,8-Pentamethyl-6-Chromanol (PMC) is the anti-oxidant moiety of vitamin E (α-tocopherol). 2,2,5,7,8-Pentamethyl-6-Chromanol has potent androgen receptor (AR) signaling modulation and anti-cancer activity against prostate cancer cell lines[1]. |
| Name | 2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-ol |
|---|---|
| Synonym | More Synonyms |
| Description | 2,2,5,7,8-Pentamethyl-6-Chromanol (PMC) is the anti-oxidant moiety of vitamin E (α-tocopherol). 2,2,5,7,8-Pentamethyl-6-Chromanol has potent androgen receptor (AR) signaling modulation and anti-cancer activity against prostate cancer cell lines[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.034g/cm3 |
|---|---|
| Boiling Point | 344.3ºC at 760 mmHg |
| Melting Point | 89-91ºC(lit.) |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 146.1ºC |
| Exact Mass | 220.14600 |
| PSA | 29.46000 |
| LogP | 3.42100 |
| Index of Refraction | 1.529 |
| InChIKey | SEBPXHSZHLFWRL-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C)O2 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2932999099 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| PMHCR |
| 2H-1-Benzopyran-6-ol,3,4-dihydro-2,2,5,7,8-pentamethyl |
| 2,2,5,7,8-pentamethyl-6-hydroxy-chromane |
| MFCD00210347 |
| Chromane C1 |
| 6-Hydroxy-2,2,5,7,8-pentamethylchroman |
| 2,2,5,7,8-pentamethylchroman-6-ol |
| 2,2,5,7,8-Pentamethyl-1-hydroxychroman |
| 2,2,5,7,8-Pentamethyl-6-hydroxychroman |
| 2,2,5,7,8-Pentamethyl-6-chromanol |
| Chroman C1 |