(R)-(+)-Carvedilol structure
|
Common Name | (R)-(+)-Carvedilol | ||
|---|---|---|---|---|
| CAS Number | 95093-99-5 | Molecular Weight | 406.47400 | |
| Density | 1.25g/cm3 | Boiling Point | 655.2ºC at 760 mmHg | |
| Molecular Formula | C24H26N2O4 | Melting Point | 114-115ºC | |
| MSDS | N/A | Flash Point | 350.1ºC | |
Use of (R)-(+)-Carvedilol(R)-Carvedilol ((R)-BM 14190), the R-enantiomer of Carvedilol, is a non-selective β/α-1 blocker. (R)-Carvedilol exerts protection against the vascular or cardiac toxicity of Doxorubicin (DOX)[1]. |
| Name | (2R)-1-(9H-carbazol-4-yloxy)-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-Carvedilol ((R)-BM 14190), the R-enantiomer of Carvedilol, is a non-selective β/α-1 blocker. (R)-Carvedilol exerts protection against the vascular or cardiac toxicity of Doxorubicin (DOX)[1]. |
|---|---|
| Related Catalog | |
| Target |
β/α-1 adrenergic receptor[1] |
| References |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 655.2ºC at 760 mmHg |
| Melting Point | 114-115ºC |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.47400 |
| Flash Point | 350.1ºC |
| Exact Mass | 406.18900 |
| PSA | 75.74000 |
| LogP | 4.12890 |
| Index of Refraction | 1.657 |
| InChIKey | OGHNVEJMJSYVRP-QGZVFWFLSA-N |
| SMILES | COc1ccccc1OCCNCC(O)COc1cccc2[nH]c3ccccc3c12 |
| Storage condition | 2-8°C |
| (R)-(+)-Carvedilol |
| S-(-)-1-(carbazol-4-yloxy)-3-[[2-(O-methoxyphenoxy)ethyl]amino]-2-propanol |
| (S)-carvedilol |
| (+)-Carvedilol |
| Carvedilol Impurity 10 |