Suc-Val-Pro-Phe-pNA structure
|
Common Name | Suc-Val-Pro-Phe-pNA | ||
|---|---|---|---|---|
| CAS Number | 95192-11-3 | Molecular Weight | 581.61700 | |
| Density | 1.337±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 971.6±65.0 °C (760 mmHg) | |
| Molecular Formula | C29H35N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Suc-Val-Pro-Phe-pNASuc-Val-Pro-Phe-pNA is a substrate for cathepsin G and can be used to detect the activity of this enzyme[1]. |
| Name | L-Phenylalaninamide, N-(3-carboxy-1-oxopropyl)-L-valyl-L-prolyl-N-(4-nitrophenyl) |
|---|---|
| Synonym | More Synonyms |
| Description | Suc-Val-Pro-Phe-pNA is a substrate for cathepsin G and can be used to detect the activity of this enzyme[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.337±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 971.6±65.0 °C (760 mmHg) |
| Molecular Formula | C29H35N5O8 |
| Molecular Weight | 581.61700 |
| Exact Mass | 581.24900 |
| PSA | 190.73000 |
| LogP | 3.57330 |
| InChIKey | QNIRAWWVNQTNGK-FXSPECFOSA-N |
| SMILES | CC(C)C(NC(=O)CCC(=O)O)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| suc-val-pro-pna |
| suc-val-pro-phe-pna |