4-Nitrophenyl Hexanoate structure
|
Common Name | 4-Nitrophenyl Hexanoate | ||
|---|---|---|---|---|
| CAS Number | 956-75-2 | Molecular Weight | 237.25200 | |
| Density | 1.14 g/cm3 | Boiling Point | 145ºC / 1mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.5ºC | |
| Name | 4-Nitrophenyl Hexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14 g/cm3 |
|---|---|
| Boiling Point | 145ºC / 1mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 146.5ºC |
| Exact Mass | 237.10000 |
| PSA | 72.12000 |
| LogP | 3.60370 |
| Index of Refraction | n20/D 1.514 |
| InChIKey | OLRXUEYZKCCEKK-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2915900090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Name: Binding affinity to chymotrypsin (unknown origin) assessed as deacetylation
Source: ChEMBL
Target: N/A
External Id: CHEMBL3284067
|
| n-caproic acid 4-nitrophenyl ester |