tert-Butyl (6-formylpyridin-2-yl)carbamate structure
|
Common Name | tert-Butyl (6-formylpyridin-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 956523-98-1 | Molecular Weight | 222.240 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 293.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.5±23.2 °C | |
| Name | tert-Butyl (6-formylpyridin-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.8±25.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.240 |
| Flash Point | 131.5±23.2 °C |
| Exact Mass | 222.100449 |
| PSA | 71.78000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | BNLOFXUVYJUBJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C=O)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl (6-formylpyridin-2-yl)carbamate |
| tert-butyl N-(6-formylpyridin-2-yl)carbamate |
| carbamic acid, N-(6-formyl-2-pyridinyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (6-formyl-2-pyridinyl)carbamate |