N-Boc-piperazine-C3-COOH structure
|
Common Name | N-Boc-piperazine-C3-COOH | ||
|---|---|---|---|---|
| CAS Number | 959053-53-3 | Molecular Weight | 300.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Boc-piperazine-C3-COOHN-Boc-piperazine-C3-COOH is a PROTAC linker, which refers to the alkyl/ether composition. Boc-N-piperazine-C3-COOH can be used in the synthesis of PROTAC PD-1/PD-L1 degrader-1 (HY-131183)[1]. |
| Name | N-Boc-piperazine-C3-COOH |
|---|
| Description | N-Boc-piperazine-C3-COOH is a PROTAC linker, which refers to the alkyl/ether composition. Boc-N-piperazine-C3-COOH can be used in the synthesis of PROTAC PD-1/PD-L1 degrader-1 (HY-131183)[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| References |
| Molecular Formula | C14H24N2O5 |
|---|---|
| Molecular Weight | 300.35 |
| InChIKey | UYDIQBGTOJOHEY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CCCC(=O)O)CC1 |
| Storage condition | 2-8°C |