N-succinimidyl-3-(2-nitrovinyl)benzoate structure
|
Common Name | N-succinimidyl-3-(2-nitrovinyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 96441-29-1 | Molecular Weight | 290.22800 | |
| Density | 1.48g/cm3 | Boiling Point | 483.7ºC at 760mmHg | |
| Molecular Formula | C13H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.3ºC | |
| Name | (2,5-dioxopyrrolidin-1-yl) 3-[(E)-2-nitroethenyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 483.7ºC at 760mmHg |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.22800 |
| Flash Point | 246.3ºC |
| Exact Mass | 290.05400 |
| PSA | 109.50000 |
| LogP | 1.61590 |
| Index of Refraction | 1.626 |
| InChIKey | QEHGLJBGZSTLIE-VOTSOKGWSA-N |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cccc(C=C[N+](=O)[O-])c1 |
| HS Code | 2925190090 |
|---|
|
~81%
N-succinimidyl-... CAS#:96441-29-1 |
| Literature: Fujii; Hayashi; Futaki; Akaji; Yajima; Kitagawa Chemical and pharmaceutical bulletin, 1984 , vol. 32, # 12 p. 5036 - 5039 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| S3NVB |
| N-Succinimidyl-3-(2-nitrovinyl)benzoate |
| N-succinimidyl-m-(2-nitrovinyl)-benzoate |
| N-Succinimidyl-meta-(2-nitrovinyl)benzoate |