Phenylfluorone structure
|
Common Name | Phenylfluorone | ||
|---|---|---|---|---|
| CAS Number | 975-17-7 | Molecular Weight | 320.296 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 646.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H12O5 | Melting Point | 300ºC | |
| MSDS | N/A | Flash Point | 243.4±25.0 °C | |
| Name | Phenylfluorone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 646.8±55.0 °C at 760 mmHg |
| Melting Point | 300ºC |
| Molecular Formula | C19H12O5 |
| Molecular Weight | 320.296 |
| Flash Point | 243.4±25.0 °C |
| Exact Mass | 320.068481 |
| PSA | 90.90000 |
| LogP | 3.19 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.791 |
| InChIKey | YDCFOUBAMGLLKA-UHFFFAOYSA-N |
| SMILES | O=c1cc2oc3cc(O)c(O)cc3c(-c3ccccc3)c-2cc1O |
| Storage condition | −20°C |
| Water Solubility | Soluble in chloroform. |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 29329995 |
|
~35%
Phenylfluorone CAS#:975-17-7 |
| Literature: Abrahams, Brendan F.; McCormick, Laura J.; Robson, Richard Journal of Molecular Structure, 2009 , vol. 920, # 1-3 p. 466 - 471 |
|
~%
Phenylfluorone CAS#:975-17-7 |
| Literature: Chemische Berichte, , vol. 37, p. 1173,1178 |
|
~%
Phenylfluorone CAS#:975-17-7 |
| Literature: Chemische Berichte, , vol. 45, p. 2889 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6,7-trihydroxy-9-phenylxanthen-3-one |
| EINECS 213-550-3 |
| 9-Pheny-3-fluorone |
| 3H-Xanthen-3-one, 2,6,7-trihydroxy-9-phenyl- |
| 2,6,7-Trihydroxy-9-phenyl-3H-xanthen-3-one |
| MFCD00005048 |