4'-NITRO-[1,1'-BIPHENYL]-4-CARBALDEHYDE structure
|
Common Name | 4'-NITRO-[1,1'-BIPHENYL]-4-CARBALDEHYDE | ||
|---|---|---|---|---|
| CAS Number | 98648-23-8 | Molecular Weight | 227.21500 | |
| Density | 1.274g/cm3 | Boiling Point | 404.9ºC at 760 mmHg | |
| Molecular Formula | C13H9NO3 | Melting Point | 117-120ºC | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | 4-(4-nitrophenyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 404.9ºC at 760 mmHg |
| Melting Point | 117-120ºC |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.21500 |
| Flash Point | 200.6ºC |
| Exact Mass | 227.05800 |
| PSA | 62.89000 |
| LogP | 3.59750 |
| Index of Refraction | 1.639 |
| InChIKey | MGHIIGWDUVNPPV-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2913000090 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| (1,1'-biphenyl)-4-nitro-4'-carboxaldehyde |
| 4'-Nitro-[1,1'-biphenyl]-4-carboxaldehyde |
| 4-Formyl-4'-nitrobiphenyl |
| 4'-nitrobiphenyl-4-carboxaldehyde |
| 4-nitrobiphenyl-4'-carbaldehyde |
| 4-(4'-nitrophenyl)benzaldehyde |
| 4'-Nitro-[1,1'-biphenyl]-4-carbaldehyde |