Adenosine 5'-triphosphate disodium salt structure
|
Common Name | Adenosine 5'-triphosphate disodium salt | ||
|---|---|---|---|---|
| CAS Number | 987-65-5 | Molecular Weight | 551.145 | |
| Density | 2.63g/cm3 | Boiling Point | 951.4ºC at 760mmHg | |
| Molecular Formula | C10H14N5Na2O13P3 | Melting Point | 188-190ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of Adenosine 5'-triphosphate disodium saltATP is a phosphate-group donor for substrate activation in metabolic reactions and the coenzyme for a large number of kinases. |
| Name | adenosine triphosphate disodium |
|---|---|
| Synonym | More Synonyms |
| Description | ATP is a phosphate-group donor for substrate activation in metabolic reactions and the coenzyme for a large number of kinases. |
|---|---|
| Related Catalog | |
| References |
[1]. Gordon, J.L., Extracellular ATP: effects, sources and fate. Biochem J, 1986. 233(2): p. 309-19. |
| Density | 2.63g/cm3 |
|---|---|
| Boiling Point | 951.4ºC at 760mmHg |
| Melting Point | 188-190ºC |
| Molecular Formula | C10H14N5Na2O13P3 |
| Molecular Weight | 551.145 |
| Exact Mass | 550.959656 |
| PSA | 314.22000 |
| InChIKey | TTWYZDPBDWHJOR-IDIVVRGQSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O.[Na+].[Na+] |
| Water Solubility | H2O: 50 mg/mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AU7417000 |
|
Quantitative phospho-proteomics reveals the Plasmodium merozoite triggers pre-invasion host kinase modification of the red cell cytoskeleton.
Sci. Rep. 6 , 19766, (2016) The invasive blood-stage malaria parasite - the merozoite - induces rapid morphological changes to the target erythrocyte during entry. However, evidence for active molecular changes in the host cell ... |
|
|
Induction of Posttranslational Modifications of Mitochondrial Proteins by ATP Contributes to Negative Regulation of Mitochondrial Function.
PLoS ONE 11 , e0150454, (2016) It is generally accepted that ATP regulates mitochondrial function through the AMPK signaling pathway. However, the AMPK-independent pathway remains largely unknown. In this study, we investigated ATP... |
|
|
DRAM1 regulates autophagy flux through lysosomes.
PLoS ONE 8 , e63245, (2013) We have previously reported that the mitochondria inhibitor 3-nitropropionic acid (3-NP), induces the expression of DNA damage-regulated autophagy modulator1 (DRAM1) and activation of autophagy in rat... |
|
Name: Kinetic parameter Vmax value for Bovine spleen NTPDase1 hydrolysis.
Source: ChEMBL
Target: Bos taurus
External Id: CHEMBL638381
|
| Adenosine, 5'-(tetrahydrogen triphosphate), sodium salt (1:2) |
| Adetphos |
| ATP disodium salt |
| Adinosine Triphosphate Disodium |
| UNII-5L51B4DR1G |
| ATP-Disodium Salt |
| Adenosine 5'-(tetrahydrogen triphosphate), disodium salt |
| adenosine triphosphate disodium |
| Disodium 5'-O-(hydroxy{[hydroxy(phosphonatooxy)phosphoryl]oxy}phosphoryl)adenosine |
| EINECS 213-579-1 |
| ATP disodium |
| Adenosine 5'-(disodium triphosphate) |
| Trinosin |
| Adenosine 5-Triphosphate Disodium Salt |
| Disodium adenosine 5'-triphosphate |
| Adenosine 5'-triphosphate disodium salt |
| Atenen |
| Circulen |
| Adenosine 5'-triphosphate, disodium salt |
| Adenosine-5'-triphosphate disodium salt |
| Disodium 5'-O-[({hydroxy[(hydroxyphosphinato)oxy]phosphoryl}oxy)phosphinato]adenosine |
| Disodium adenosine triphosphate |
| MFCD00080339 |
| DISODIUM ATP |
| ATP |
| ATP (disodium salt) |