DMT-dT Phosphoramidite structure
|
Common Name | DMT-dT Phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 98796-51-1 | Molecular Weight | 744.813 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H49N4O8P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of DMT-dT PhosphoramiditeDMT-dT Phosphoramidite is typically used in the synthesis of DNA[1]. |
| Name | DMT-dT Phosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | DMT-dT Phosphoramidite is typically used in the synthesis of DNA[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C40H49N4O8P |
|---|---|
| Molecular Weight | 744.813 |
| Exact Mass | 744.328796 |
| PSA | 150.86000 |
| LogP | 8.09 |
| InChIKey | UNOTXUFIWPRZJX-CEXSRUIHSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cc(C)c(=O)[nH]c3=O)CC2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Storage condition | -20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| 5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]-3'-O-[(2-cyanoethoxy)(diisopropylamino)phosphino]thymidine |
| 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| Thymidine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[[bis(1-methylethyl)amino](2-cyanoethoxy)phosphino]- |
| DMT-dT-CE-Phosphoramidite |