Boc-L-Valine structure
|
Common Name | Boc-L-Valine | ||
|---|---|---|---|---|
| CAS Number | 13734-41-3 | Molecular Weight | 217.262 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 341.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO4 | Melting Point | 77-80 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 160.5±23.2 °C | |
Use of Boc-L-ValineBoc-L-Valine is a valine derivative[1]. |
| Name | (S)-2-(Boc-amino)-3-methylbutyric acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-L-Valine is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 341.8±25.0 °C at 760 mmHg |
| Melting Point | 77-80 °C(lit.) |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.262 |
| Flash Point | 160.5±23.2 °C |
| Exact Mass | 217.131409 |
| PSA | 75.63000 |
| LogP | 1.98 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | SZXBQTSZISFIAO-ZETCQYMHSA-N |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)O |
| Water Solubility | insoluble |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Prodrug approach to improve absorption of prednisolone.
Int. J. Pharm. 487 , 242-9, (2015) Amino acid and dipeptide prodrugs have been developed to examine their potential in enhancing aqueous solubility and permeability as well as to bypass P-glycoprotein (P-gp) mediated cellular efflux of... |
| (2S)-2-[(tert-butoxy)carbonylamino]-3-methylbutanoic acid |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-valine |
| (S)-2-(Boc-amino)-3-methylbutyric acid |
| N-t-Butoxycarbonyl-L-valine |
| BOC-L-Valine |
| BOC-VALINE-OH |
| BOC-VAL-OH |
| BOC-VALINE |
| MFCD00065605 |
| N-(tert-Butoxycarbonyl)-L-valin |
| Boc-L-Val-OH |
| (S)-2-(Boc-amino)-3-methylbutyricacid |
| Boc-L-Valine-OH |
| N-tert-Butoxycarbonyl-L-valine |
| EINECS 237-307-6 |
| (2S)-3-Methyl-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid |
| N-BOC-L-VALINE |
| t-Boc-L-valine |
| N-Boc-valine |
| N-tert-Butyloxycarbonyl-L-valine |
| BOC-L-VAL |
| N-(tert-Butoxycarbonyl)-L-valine |
| BOC-VAL |
| (S)-2-((tert-Butoxycarbonyl)amino)-3-methylbutanoic acid |
| tBoc-LVal-OH |