Boc-Hyp(Bzl)-OH structure
|
Common Name | Boc-Hyp(Bzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 54631-81-1 | Molecular Weight | 321.368 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 461.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO5 | Melting Point | 64-76ºC | |
| MSDS | USA | Flash Point | 232.8±28.7 °C | |
| Name | (2S,4R)-4-(Benzyloxy)-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.3±45.0 °C at 760 mmHg |
| Melting Point | 64-76ºC |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.368 |
| Flash Point | 232.8±28.7 °C |
| Exact Mass | 321.157623 |
| PSA | 76.07000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | DGIGGVANZFKXLS-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(OCc2ccccc2)CC1C(=O)O |
| Storage condition | Store at 0°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4R)-4-(Benzyloxy)-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-proline |
| (2S,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylmethoxypyrrolidine-2-carboxylic acid |
| (4R)-4-(Benzyloxy)-1-(tert-butoxycarbonyl)-L-proline |
| MFCD00037325 |
| Boc-Hyp(Bzl)-OH.DCHA |
| Boc-O-benzyl-trans-4-hydroxy-L-proline |
| Boc-Hyp(Bzl)-OH |