Fmoc-Hyp(Bzl)-OH structure
|
Common Name | Fmoc-Hyp(Bzl)-OH | ||
|---|---|---|---|---|
| CAS Number | 174800-02-3 | Molecular Weight | 443.49100 | |
| Density | 1.34 g/cm3 | Boiling Point | 640ºC at 760 mmHg | |
| Molecular Formula | C27H25NO5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 340.9ºC | |
| Name | (2S,4R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-4-(benzyloxy)pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34 g/cm3 |
|---|---|
| Boiling Point | 640ºC at 760 mmHg |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.49100 |
| Flash Point | 340.9ºC |
| Exact Mass | 443.17300 |
| PSA | 76.07000 |
| LogP | 4.61770 |
| Appearance of Characters | Powder | White |
| Index of Refraction | 1.669 |
| InChIKey | XGFMHBUVVWZBFT-CLOONOSVSA-N |
| SMILES | O=C(O)C1CC(OCc2ccccc2)CN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
|
~%
Fmoc-Hyp(Bzl)-OH CAS#:174800-02-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 9 p. 2151 - 2154 |
|
~%
Fmoc-Hyp(Bzl)-OH CAS#:174800-02-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 9 p. 2151 - 2154 |
|
~%
Fmoc-Hyp(Bzl)-OH CAS#:174800-02-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 9 p. 2151 - 2154 |
|
~%
Fmoc-Hyp(Bzl)-OH CAS#:174800-02-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 9 p. 2151 - 2154 |
| Fmoc-Hyp(Bzl)-OH |
| (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-phenylmethoxypyrrolidine-2-carboxylic acid |