3'-O-Methylorobol structure
|
Common Name | 3'-O-Methylorobol | ||
|---|---|---|---|---|
| CAS Number | 36190-95-1 | Molecular Weight | 300.263 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 574.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4±23.6 °C | |
Use of 3'-O-Methylorobol3'-O-Methylorobol, an antioxidant flavonoid, exhibits moderate antioxidant activity in the 2,2-diphenyl-1-picrylhydrazyl free radical scavenging assay[1]. |
| Name | 5,7-Dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3'-O-Methylorobol, an antioxidant flavonoid, exhibits moderate antioxidant activity in the 2,2-diphenyl-1-picrylhydrazyl free radical scavenging assay[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 574.3±50.0 °C at 760 mmHg |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.263 |
| Flash Point | 219.4±23.6 °C |
| Exact Mass | 300.063385 |
| PSA | 100.13000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | ZMFBGWWGXBNJAC-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2coc3cc(O)cc(O)c3c2=O)ccc1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
|
~%
3'-O-Methylorobol CAS#:36190-95-1 |
| Literature: Chemler, Joseph A.; Lim, Chin Giaw; Daiss, John L.; Koffas, Mattheos A.G. Chemistry and Biology, 2010 , vol. 17, # 4 p. 392 - 401 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,7,4'-trihydroxy-3',6-dimethoxyflavone |
| 3'-methoxy-4',5,7-trihydroxyisoflavone |
| 5,7,4'-trihydroxy-6,3'-dimethoxyflavone |
| JACEOSIDINE |
| 3'-methylorobol |
| 3'-O-methylorobol |
| 5,7,4'-trihydroxy-3'-methoxyisoflavone |
| 4',5,7-Trihydroxy-3',6-dimethoxyflavone |
| orobol 3'-methyl ether |
| 5,7-Dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-4H-chromen-4-one |
| Jaceosidin |