4,4'-Diphenylmethane diisocyanate structure
|
Common Name | 4,4'-Diphenylmethane diisocyanate | ||
|---|---|---|---|---|
| CAS Number | 101-68-8 | Molecular Weight | 250.252 | |
| Density | 1.19 | Boiling Point | 392 ºC | |
| Molecular Formula | C15H10N2O2 | Melting Point | 38-44 °C | |
| MSDS | Chinese USA | Flash Point | 196 ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | diphenylmethane-4,4'-diisocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19 |
|---|---|
| Boiling Point | 392 ºC |
| Melting Point | 38-44 °C |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.252 |
| Flash Point | 196 ºC |
| Exact Mass | 250.074234 |
| PSA | 58.86000 |
| LogP | 4.93 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| SMILES | O=C=Nc1ccc(Cc2ccc(N=C=O)cc2)cc1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with alcohols. |
| Water Solubility | decomposes |
| Freezing Point | 37℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H317-H319-H332-H334-H335-H351-H373 |
| Precautionary Statements | P261-P280-P284-P304 + P340 + P312-P305 + P351 + P338-P342 + P311 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20;R36/37/38;R42/43 |
| Safety Phrases | S23;S36/37;S45 |
| RIDADR | UN 2811 |
| RTECS | NQ9350000 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 29291090 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2929109000 |
|---|---|
| Summary | 2929109000. other isocyanates. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Role of dermal exposure in systemic intake of methylenediphenyl diisocyanate (MDI) among construction and boat building workers.
Toxicol. Lett. 232(3) , 595-600, (2015) The causal relationship between inhalation exposure to methylenediphenyl diisocyanate (MDI) and the risk of occupational asthma is well known, but the role of dermal exposure and dermal uptake of MDI ... |
|
|
Development of sandwich ELISAs for the detection of aromatic diisocyanate adducts
J. Immunol. Methods 397(1-2) , 66-70, (2013) Diisocyanates (dNCOs) are highly reactive low molecular weight chemicals commonly used in the manufacturing industry. Occupational exposures to dNCOs have been shown to elicit allergic sensitization a... |
|
|
Genetic variants in antioxidant genes are associated with diisocyanate-induced asthma.
Toxicol. Sci. 129(1) , 166-73, (2012) Diisocyanates are a common cause of occupational asthma, but risk factors are not well defined. A case-control study was conducted to investigate whether genetic variants of antioxidant defense genes,... |
| EINECS 202-966-0 |
| 4,4′-Methylenebis(phenyl isocyanate) |
| 4,4'-Methylenediphenyl diisocyanate |
| 4,4'-Methylenebis(phenyl isocyanate) |
| diphenylmethane-4,4'-diisocyanate |
| MFCD00036131 |
| desmodur44 |
| caradate30 |
| MDI |
| hylenem50 |
| methylene 4,4'-diphenyl diisocyanate |
| 1,1'-Methylenebis(4-isocyanatobenzene) |
| p,p'-diphenylmethane diisocyanate |
| 4,4'-Diisocyanatodiphenylmethane |
| Benzene, 1,1'-methylenebis[4-isocyanato- |
| Methylene diphenyl diisocyanate |
| Methylene di-p-phenyl diisocyanate,flakes |
| PMDI |
| 4,4-Diphenylmethane Diisocyanate |
| bis(4-isocyanatophenyl)methane |
| 4,4'-diphenylmethanediisocyanate |
| 1,1'-methanediylbis(4-isocyanatobenzene) |
| Methylenediphenyl 4,4'-Diisocyanate |
| 4,4'-Diphenylmethane diisocyanate |
| 4,4'-MDI |
| Isonate |
| 4,4'-Methylenediphenyl isocyanate |
| methylene |
| 4,4'-methylene bisphenyl diisocyanate |