CP 376395 hydrochloride structure
|
Common Name | CP 376395 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1013933-37-3 | Molecular Weight | 362.94 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H31ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CP 376395 hydrochlorideCP 376395 hydrochloride is a potent, selective, and brain-penetrable Corticotropin releasing factor 1 (CRF1) receptor antagonist[1][2]. |
| Name | CP-376395 hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | CP 376395 hydrochloride is a potent, selective, and brain-penetrable Corticotropin releasing factor 1 (CRF1) receptor antagonist[1][2]. |
|---|---|
| Related Catalog | |
| Target |
CRFR1 CRFR2 |
| References |
| Molecular Formula | C21H31ClN2O |
|---|---|
| Molecular Weight | 362.94 |
| Exact Mass | 362.21200 |
| PSA | 34.15000 |
| LogP | 6.89140 |
| InChIKey | UDIOZDHQQNYISB-UHFFFAOYSA-N |
| SMILES | CCC(CC)Nc1cc(C)nc(Oc2c(C)cc(C)cc2C)c1C.Cl |
| Remoxipride hydrochloride |