2-phenylquinazolin-4-ol structure
|
Common Name | 2-phenylquinazolin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 1022-45-3 | Molecular Weight | 222.242 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 398.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6±23.2 °C | |
| Name | 2-Phenylquinazolin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.2±25.0 °C at 760 mmHg |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.242 |
| Flash Point | 194.6±23.2 °C |
| Exact Mass | 222.079315 |
| PSA | 46.01000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | VDULOAUXSMYUMG-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(-c2ccccc2)nc2ccccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Phenyl-4(1H)-quinazolinone |
| 2-phenyl-1H-quinazolin-4-one |
| 2-phenylquinazolin-4(3H)-one |
| 4(1H)-Quinazolinone, 2-phenyl- |
| 2-phenyl quinazolin-4-ol |
| 2-phenylquinazolin-4-ol |