benzyl 4-methylbenzenesulfonate
benzyl 4-methylbenzenesulfonate structure
|
Common Name | benzyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 1024-41-5 | Molecular Weight | 262.32400 | |
| Density | 1.222g/cm3 | Boiling Point | 412.7ºC at 760mmHg | |
| Molecular Formula | C14H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 412.7ºC at 760mmHg |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.32400 |
| Flash Point | 203.4ºC |
| Exact Mass | 262.06600 |
| PSA | 51.75000 |
| LogP | 3.98130 |
| Vapour Pressure | 1.21E-06mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | OVHDZBAFUMEXCX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
CAS#:98-59-9
CAS#:100-51-6
CAS#:4124-41-8
CAS#:14642-79-6
CAS#:455-16-3
CAS#:104-15-4
CAS#:1927-62-4
CAS#:25370-91-6
CAS#:16836-95-6
CAS#:100-44-7
CAS#:350-50-5
CAS#:4560-41-2
CAS#:451-40-1
CAS#:946-80-5
CAS#:22877-01-6
CAS#:140-11-4
CAS#:67696-28-0
CAS#:150-60-7
CAS#:536-57-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzyl 4-toluenesulfonate |
| benzyl p-toluenesulphonate |
| Benzyl tosylate |
| toluene-4-sulfonic acid benzyl ester |
| benzyl p-toluenesulfonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of benzyl 4-methylbenzenesulfonate? |
| A: The English name of benzyl 4-methylbenzenesulfonate is benzyl 4-methylbenzenesulfonate. |
| Q: What is the CAS number of benzyl 4-methylbenzenesulfonate? |
| A: CAS number of benzyl 4-methylbenzenesulfonate is 1024-41-5. |
| Q: What English synonyms does benzyl 4-methylbenzenesulfonate have? |
| A: English synonyms of benzyl 4-methylbenzenesulfonate: Benzyl 4-toluenesulfonate, benzyl p-toluenesulphonate, Benzyl tosylate, toluene-4-sulfonic acid benzyl ester, benzyl p-toluenesulfonate. |
| Q: What is the molecular weight of benzyl 4-methylbenzenesulfonate? |
| A: Molecular weight of benzyl 4-methylbenzenesulfonate is 262.32400. |
| Q: What is the polar surface area (PSA) of benzyl 4-methylbenzenesulfonate? |
| A: Polar surface area (PSA) of benzyl 4-methylbenzenesulfonate is 51.75000. |
| Q: What is the InChIKey of benzyl 4-methylbenzenesulfonate? |
| A: InChIKey of benzyl 4-methylbenzenesulfonate is OVHDZBAFUMEXCX-UHFFFAOYSA-N. |
| Q: What are the upstream materials of benzyl 4-methylbenzenesulfonate? |
| A: Related upstream materials(CAS) of benzyl 4-methylbenzenesulfonate: 98-59-9;100-51-6;4124-41-8;14642-79-6;455-16-3;104-15-4;1927-62-4;25370-91-6;16836-95-6;100-44-7. |
| Q: What are the downstream products of benzyl 4-methylbenzenesulfonate? |
| A: Related downstream products(CAS) of benzyl 4-methylbenzenesulfonate: 350-50-5;4560-41-2;451-40-1;946-80-5;22877-01-6;140-11-4;100-51-6;67696-28-0;150-60-7;536-57-2. |
| Q: What is the molecular formula of benzyl 4-methylbenzenesulfonate? |
| A: Molecular formula of benzyl 4-methylbenzenesulfonate is C14H14O3S. |
| Q: What is the LogP of benzyl 4-methylbenzenesulfonate? |
| A: LogP of benzyl 4-methylbenzenesulfonate is 3.98130. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |