LB-100 structure
|
Common Name | LB-100 | ||
|---|---|---|---|---|
| CAS Number | 1026680-07-8 | Molecular Weight | 268.309 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 486.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.3±28.7 °C | |
Use of LB-100LB-100 is a small-molecular protein phosphatase 2A(PP2A)inhibitor with IC50 of 0.85 μM and 3.87 μM in BxPc-3 and Panc-1 cells. |
| Name | endothall 4-methylpiperazine monoamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.9±45.0 °C at 760 mmHg |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.309 |
| Flash Point | 248.3±28.7 °C |
| Exact Mass | 268.142303 |
| PSA | 70.08000 |
| LogP | -0.56 |
| Appearance of Characters | white solid |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | JUQMLSGOTNKJKI-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=O)C2C3CCC(O3)C2C(=O)O)CC1 |
| Storage condition | -20℃ |
| 7-Oxabicyclo[2.2.1]heptane-2-carboxylic acid, 3-[(4-methyl-1-piperazinyl)carbonyl]- |
| 3-[(4-Methyl-1-piperazinyl)carbonyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| empm |
| LB-100 |