Leupeptin hemisulfate salt structure
|
Common Name | Leupeptin hemisulfate salt | ||
|---|---|---|---|---|
| CAS Number | 103476-89-7 | Molecular Weight | 475.59 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H38N6O4.1/2H2SO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Leupeptin hemisulfate saltLeupeptin hemisulfate is a reversible, competitive serine/cysteine protease inhibitor. |
| Name | Leupeptin hemisulfate |
|---|---|
| Synonym | More Synonyms |
| Description | Leupeptin hemisulfate is a reversible, competitive serine/cysteine protease inhibitor. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C20H38N6O4.1/2H2SO4 |
| Molecular Weight | 475.59 |
| PSA | 166.27000 |
| LogP | 1.16 |
| Index of Refraction | 1.557 |
| InChIKey | CIPMKIHUGVGQTG-VFFZMTJFSA-N |
| SMILES | CC(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C=O)CCCN=C(N)N.CC(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C=O)CCCN=C(N)N.O=S(=O)(O)O |
| Storage condition | -20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | 22-24/25-36/37-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29241900 |
| HS Code | 29241900 |
|---|
|
IL-10 plays a pivotal role in anti-inflammatory effects of resveratrol in activated microglia cells.
Int. Immunopharmacol. 24(2) , 369-76, (2015) The development of agents that can modulate microglial activation has been suggested as one potential strategy for the treatment or prevention of neurodegenerative diseases. Among these agents, resver... |
|
|
Nerve growth factor-induced synapse-like structures in contralateral sensory ganglia contribute to chronic mirror-image pain.
Pain 156 , 2295-309, (2015) Elevated nerve growth factor (NGF) in the contralateral dorsal root ganglion (DRG) mediates mirror-image pain after peripheral nerve injury, but the underlying mechanism remains unclear. Using intrath... |
|
|
Calcium Regulates the Activity and Structural Stability of Tpr, a Bacterial Calpain-like Peptidase.
J. Biol. Chem. 290 , 27248-60, (2015) Porphyromonas gingivalis is a peptide-fermenting asaccharolytic periodontal pathogen. Its genome contains several genes encoding cysteine peptidases other than gingipains. One of these genes (PG1055) ... |
| L-Leucinamide, N-acetyl-L-leucyl-N-[(1S)-4-[(diaminomethylene)amino]-1-formylbutyl]- |
| AC-LLR-CHO |
| MFCD00037012 |
| LEUPEPTIN SULFATE |
| N-acetyl-L-leucyl-N-[(1S)-4-{[amino(imino)methyl]amino}-1-formylbutyl]-L-leucinamide |
| AC-LEU-LEU-ARG-CHO |
| N-acetyl-L-leucyl-N-{(2S)-5-[(diaminomethylidene)amino]-1-oxopentan-2-yl}-L-leucinamide |
| LEUPEPTIN 1/2 H2SO4 |
| Leupeptin,synthetic |
| Leupeptin,Microbial |
| Leupeptin |
| N-Acetyl-L-leucyl-N-{(2S)-5-[(diaminomethylene)amino]-1-oxo-2-pentanyl}-L-leucinamide |
| AC-LEU-LEU-ARGININAL |
| N-Acetyl-L-leucyl-L-leucyl-L-argininal |
| Synonym Acetyl-Leu-L |
| Leupeptin (hemisulfate) |