Saridegib structure
|
Common Name | Saridegib | ||
|---|---|---|---|---|
| CAS Number | 1037210-93-7 | Molecular Weight | 504.76800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H48N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SaridegibSaridegib is a potent and specific inhibitor of Smoothened (Smo), a key signaling transmembrane protein in the Hedgehog (Hh) pathway. |
| Name | N-[(3R,3'R,3'aS,4aR,6'S,6aR,6bS,7'aR,9S,12aS,12bS)-3',6',11,12b-tetramethylspiro[1,2,3,4,4a,5,6,6a,6b,7,8,10,12,12a-tetradecahydronaphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-yl]methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Saridegib is a potent and specific inhibitor of Smoothened (Smo), a key signaling transmembrane protein in the Hedgehog (Hh) pathway. |
|---|---|
| Related Catalog | |
| Target |
Smo[1]. |
| In Vivo | Evidence from a genetically engineered mouse model of pancreatic cancer demonstrates that Saridegib (IPI-926) can deplete tumor-associated stromal tissue and increase intratumoral mean vessel density. These changes result in enhanced delivery of concurrently administered systemic agents such as gemcitabine, leading to a decreased tumor burden and prolonged survival in this mouse model[1]. |
| References |
| Molecular Formula | C29H48N2O3S |
|---|---|
| Molecular Weight | 504.76800 |
| Exact Mass | 504.33900 |
| PSA | 75.81000 |
| LogP | 6.82930 |
| InChIKey | HZLFFNCLTRVYJG-WWGOJCOQSA-N |
| SMILES | CC1=C2CC3C(CCC4CC(NS(C)(=O)=O)CCC43C)C2CCC2(C1)OC1CC(C)CNC1C2C |
| Storage condition | 2-8℃ |
|
~%
Saridegib CAS#:1037210-93-7 |
| Literature: WO2008/83248 A2, ; Page/Page column 59 ; |
|
~%
Saridegib CAS#:1037210-93-7 |
| Literature: WO2011/17551 A1, ; |
|
~%
Saridegib CAS#:1037210-93-7 |
| Literature: WO2011/17551 A1, ; |
|
~%
Saridegib CAS#:1037210-93-7 |
| Literature: WO2011/17551 A1, ; |
|
~%
Saridegib CAS#:1037210-93-7 |
| Literature: WO2011/17551 A1, ; |
| unii-jt96fpu35x |
| ipi 926 |
| ip9 free base |
| saridegib |
| fin-5 |