(-)-DIP-BROMIDE(TM) structure
|
Common Name | (-)-DIP-BROMIDE(TM) | ||
|---|---|---|---|---|
| CAS Number | 104114-70-7 | Molecular Weight | 365.19900 | |
| Density | 1.12g/cm3 | Boiling Point | 373.4ºC at 760mmHg | |
| Molecular Formula | C20H34BBr | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.6ºC | |
| Name | bromo-bis[(1R,3R,4S,5R)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 373.4ºC at 760mmHg |
| Molecular Formula | C20H34BBr |
| Molecular Weight | 365.19900 |
| Flash Point | 179.6ºC |
| Exact Mass | 364.19400 |
| LogP | 6.51740 |
| Vapour Pressure | 1.93E-05mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | FKBAVEASVZAXFW-VMAIWCPRSA-N |
| SMILES | CC1C(B(Br)C2CC3CC(C2C)C3(C)C)CC2CC1C2(C)C |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
|
~83%
(-)-DIP-BROMIDE(TM) CAS#:104114-70-7 |
| Literature: Srebnik, M.; Joshi, N. N.; Brown, Herbert C. Israel Journal of Chemistry, 1989 , vol. 29, p. 229 - 238 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (isopinocamphenyl)2BBr |
| (-)-B-bromodiisopinocamphenylborane |
| B-bromodiisopinocampheylborane |
| (1R)-(-)-B-Bromodiisopinocampheylborane |
| (-)-Ipc2BBr |
| MFCD00192103 |