Benzenamine,4-nitro-N-[(4-nitrophenyl)methylene]- structure
|
Common Name | Benzenamine,4-nitro-N-[(4-nitrophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 10480-05-4 | Molecular Weight | 271.22800 | |
| Density | 1.35g/cm3 | Boiling Point | 479.8ºC at 760mmHg | |
| Molecular Formula | C13H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244ºC | |
| Name | N,1-bis(4-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 479.8ºC at 760mmHg |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.22800 |
| Flash Point | 244ºC |
| Exact Mass | 271.05900 |
| PSA | 104.00000 |
| LogP | 4.30000 |
| Vapour Pressure | 6.68E-09mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | KRLIGBJKICAQHW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Nc2ccc([N+](=O)[O-])cc2)cc1 |
|
~98%
Benzenamine,4-n... CAS#:10480-05-4 |
| Literature: Rothenberg; Downie; Raston; Scott Journal of the American Chemical Society, 2001 , vol. 123, # 36 p. 8701 - 8708 |
| p-nitrobenzylidene-p-nitrophenylamine |