DCAI hydrochloride structure
|
Common Name | DCAI hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1049742-84-8 | Molecular Weight | 279.593 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DCAI hydrochlorideDCAI hydrochloride is an inhibitor of nucleotide exchange and nucleotide release, by binding to the pocket adjacent to the Ras-SOS interface. |
| Name | MFCD04967099 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13Cl3N2 |
|---|---|
| Molecular Weight | 279.593 |
| Exact Mass | 278.014435 |
| InChIKey | ZHOLRBWPQNSIHI-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c2cc(Cl)cc(Cl)c2c1CCN.Cl |
| 1H-Indole-3-ethanamine, 4,6-dichloro-2-methyl-, hydrochloride (1:1) |
| 2-(4,6-dichloro-2-methyl-1H-indol-3-yl)ethanamine hydrochloride |
| 2-(4,6-Dichloro-2-methyl-1H-indol-3-yl)ethanamine hydrochloride (1:1) |
| MFCD04967099 |