3-ethyl-2-methyl-2H-benzo[g]chromene-5,10-dione structure
|
Common Name | 3-ethyl-2-methyl-2H-benzo[g]chromene-5,10-dione | ||
|---|---|---|---|---|
| CAS Number | 105438-05-9 | Molecular Weight | 254.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-2-methyl-2H-benzo[g]chromene-5,10-dione |
|---|
| Molecular Formula | C16H14O3 |
|---|---|
| Molecular Weight | 254.28100 |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 3.07480 |
| InChIKey | BYNTXRQRPHPVQT-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(OC1C)C(=O)c1ccccc1C2=O |
|
~55%
3-ethyl-2-methy... CAS#:105438-05-9 |
| Literature: Bock, Klaus; Jacobsen, Niels; Terem, Bulent Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1986 , p. 659 - 664 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |