7-nitroindole-3-carboxaldehyde structure
|
Common Name | 7-nitroindole-3-carboxaldehyde | ||
|---|---|---|---|---|
| CAS Number | 10553-14-7 | Molecular Weight | 190.15600 | |
| Density | 1.516g/cm3 | Boiling Point | 441.5ºC at 760 mmHg | |
| Molecular Formula | C9H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.8ºC | |
| Name | 7-Nitroindole-3-carboxyaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 441.5ºC at 760 mmHg |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.15600 |
| Flash Point | 220.8ºC |
| Exact Mass | 190.03800 |
| PSA | 78.68000 |
| LogP | 2.41180 |
| Vapour Pressure | 5.43E-08mmHg at 25°C |
| Index of Refraction | 1.764 |
| InChIKey | ADGKBVRTGVODMM-UHFFFAOYSA-N |
| SMILES | O=Cc1c[nH]c2c([N+](=O)[O-])cccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~78%
7-nitroindole-3... CAS#:10553-14-7 |
| Literature: Zheng, Jing; Deng, Lijuan; Chen, Minfeng; Xiao, Xuzhi; Xiao, Shengwei; Guo, Cuiping; Xiao, Gaokeng; Bai, Liangliang; Ye, Wencai; Zhang, Dongmei; Chen, Heru European Journal of Medicinal Chemistry, 2013 , vol. 65, p. 158 - 167 |
|
~%
7-nitroindole-3... CAS#:10553-14-7 |
| Literature: US2002/25957 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD01074519 |
| 7-nitro-1H-indole-3-carbaldehyde |