N3-PEG3-CH2CH2COOH structure
|
Common Name | N3-PEG3-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1056024-94-2 | Molecular Weight | 247.248 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-PEG3-CH2CH2COOHN3-PEG3-CH2CH2COOH a PEG-based PROTAC linker can be used in the synthesis of BI-3663 (HY-111546), BI-4216 and BI-0319. Azido-PEG3-acid is also a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | 3-{2-[2-(2-Azidoethoxy)ethoxy]ethoxy}propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N3-PEG3-CH2CH2COOH a PEG-based PROTAC linker can be used in the synthesis of BI-3663 (HY-111546), BI-4216 and BI-0319. Azido-PEG3-acid is also a non-cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
PEGs Non-cleavable |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Molecular Formula | C9H17N3O5 |
|---|---|
| Molecular Weight | 247.248 |
| Exact Mass | 247.116821 |
| LogP | -0.71 |
| InChIKey | VWJGWKZZFZMGGY-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCC(=O)O |
| Propanoic acid, 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]- |
| 3-{2-[2-(2-Azidoethoxy)ethoxy]ethoxy}propanoic acid |