BPH-715 structure
|
Common Name | BPH-715 | ||
|---|---|---|---|---|
| CAS Number | 1059677-23-4 | Molecular Weight | 423.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H31NO7P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BPH-715BPH-715 is a bisphosphonate, inhibits Plasmodium liver-stage growth, with an IC50 of 10 μM for Plasmodium exoerythrocytic forms in HepG2 cells[1]. |
| Name | [2-(3-decoxypyridin-1-ium-1-yl)-1-phosphonoethyl]-hydroxyphosphinate |
|---|---|
| Synonym | More Synonyms |
| Description | BPH-715 is a bisphosphonate, inhibits Plasmodium liver-stage growth, with an IC50 of 10 μM for Plasmodium exoerythrocytic forms in HepG2 cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H31NO7P2 |
|---|---|
| Molecular Weight | 423.37800 |
| Exact Mass | 423.15800 |
| PSA | 150.62000 |
| LogP | 3.61330 |
| InChIKey | QYJHUOZDBUEKQC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOc1ccc[n+](CC(P(=O)([O-])O)P(=O)(O)O)c1 |
| bisphosphonate,15 |
| UNII-YD43M7UAP4 |
| BPH-715 |
| GTPL3196 |