β-D-Glucose pentaacetate structure
|
Common Name | β-D-Glucose pentaacetate | ||
|---|---|---|---|---|
| CAS Number | 604-69-3 | Molecular Weight | 390.339 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 434.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H22O11 | Melting Point | 129-133ºC | |
| MSDS | N/A | Flash Point | 188.1±28.8 °C | |
Use of β-D-Glucose pentaacetateβ-D-Glucose Pentaacetate (Penta-O-acetyl-β-D-glucopyranose) is used in biochemical reaction. |
| Name | Beta-D-Glucose Pentaacetate |
|---|---|
| Synonym | More Synonyms |
| Description | β-D-Glucose Pentaacetate (Penta-O-acetyl-β-D-glucopyranose) is used in biochemical reaction. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.8±45.0 °C at 760 mmHg |
| Melting Point | 129-133ºC |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.339 |
| Flash Point | 188.1±28.8 °C |
| Exact Mass | 390.116211 |
| PSA | 140.73000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | LPTITAGPBXDDGR-IBEHDNSVSA-N |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
|---|---|
| Risk Phrases | R21 |
| Safety Phrases | S24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 29400090 |
|---|
| Pentaacetyl-β-D-glucopyranose |
| MFCD00006597 |
| β-D-glucopyranose pentaacetate |
| β-D-Glucopyranose, pentaacetate |
| EINECS 210-074-8 |
| β-D-(+)-Glucose pentaacetate |
| Penta-O-acetyl-β-D-glucopyranose |
| 1,2,3,4,6-Penta-O-acetyl-β-D-glucopyranose |
| 1,2,3,4,6-Penta-O-acetyl-.β.-D-glucopyranose |
| Acetyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside |
| β-D-Glucose pentaacetate |