4'-nitrophenyl tetra-o-acetyl-beta-d-glucopyranoside
4'-nitrophenyl tetra-o-acetyl-beta-d-glucopyranoside structure
|
Common Name | 4'-nitrophenyl tetra-o-acetyl-beta-d-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 5987-78-0 | Molecular Weight | 469.39600 | |
| Density | 1.38g/cm3 | Boiling Point | 559.3ºC at 760 mmHg | |
| Molecular Formula | C20H23NO12 | Melting Point | 175ºC | |
| MSDS | N/A | Flash Point | 207.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 559.3ºC at 760 mmHg |
| Melting Point | 175ºC |
| Molecular Formula | C20H23NO12 |
| Molecular Weight | 469.39600 |
| Flash Point | 207.1ºC |
| Exact Mass | 469.12200 |
| PSA | 169.48000 |
| LogP | 1.57990 |
| Index of Refraction | 1.54 |
| InChIKey | BEUISCKWILNFIL-OUUBHVDSSA-N |
| SMILES | CC(=O)OCC1OC(Oc2ccc([N+](=O)[O-])cc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 6 | |
CAS#:100-02-7
CAS#:572-09-8
CAS#:74808-10-9
CAS#:108-24-7
CAS#:2492-87-7
CAS#:604-69-3
CAS#:78942-86-6
CAS#:83-87-4
CAS#:123-54-6
CAS#:106927-48-4
CAS#:129411-62-7
CAS#:17691-02-0
CAS#:3482-57-3
CAS#:20818-25-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: CAS number of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is 5987-78-0. |
| Q: What is the molecular weight of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: Molecular weight of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is 469.39600. |
| Q: What is the melting point of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: Melting point of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is 175ºC. |
| Q: What are the upstream materials of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: Related upstream materials(CAS) of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside: 100-02-7;572-09-8;74808-10-9;108-24-7;2492-87-7;604-69-3;78942-86-6;83-87-4;123-54-6. |
| Q: What English synonyms does p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside have? |
| A: English synonyms of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-nitrophenoxy)oxan-2-yl]methyl acetate. |
| Q: What is the boiling point of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: Boiling point of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is 559.3ºC at 760 mmHg. |
| Q: What is the English name of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: The English name of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside. |
| Q: What is the LogP of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: LogP of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is 1.57990. |
| Q: What is the molecular formula of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: Molecular formula of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is C20H23NO12. |
| Q: What is the polar surface area (PSA) of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside? |
| A: Polar surface area (PSA) of p-Nitrophenyl-2,3,4,6-Tetra-O-acetyl-β-D-glucopyranoside is 169.48000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |