1-(4-nitrobenzyl)-1H-pyrazole structure
|
Common Name | 1-(4-nitrobenzyl)-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 110525-57-0 | Molecular Weight | 203.197 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 394.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4±23.2 °C | |
| Name | 1-(4-Nitrobenzyl)-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.5±25.0 °C at 760 mmHg |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.197 |
| Flash Point | 192.4±23.2 °C |
| Exact Mass | 203.069473 |
| PSA | 63.64000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | ZFWQFBNNHCBSFT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cn2cccn2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
|
~94%
1-(4-nitrobenzy... CAS#:110525-57-0 |
| Literature: Beugelmans, Rene; Lechevalier, Andre Tetrahedron Letters, 1986 , vol. 27, # 51 p. 6209 - 6212 |
|
~73%
1-(4-nitrobenzy... CAS#:110525-57-0 |
| Literature: TETRA DISCOVERY PARTNERS, LLC.; GURNEY, Mark, E.; HAGEN, Timothy, J.; MO, Xuesheng; VELLEKOOP, A.; ROMERO, Donna, L.; CAMPBELL, Robert, F.; WALKER, Joel, R.; ZHU, Lei Patent: WO2014/66659 A1, 2014 ; Location in patent: Paragraph 0824 ; |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-nitrobenzyl)-1H-pyrazole |
| 1-[(4-Nitrophenyl)methyl]pyrazole |
| 1H-Pyrazole, 1-[(4-nitrophenyl)methyl]- |