Coenzyme Q10-d6 structure
|
Common Name | Coenzyme Q10-d6 | ||
|---|---|---|---|---|
| CAS Number | 110971-02-3 | Molecular Weight | 869.38 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 869.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C59H84D6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.6±34.3 °C | |
Use of Coenzyme Q10-d6Coenzyme Q10-d6 is deuterium labeled Coenzyme Q10. Coenzyme Q10 is an essential cofactor of the electron transport chain and a potent antioxidant agent. |
| Name | Coenzyme Q10-d6 |
|---|---|
| Synonym | More Synonyms |
| Description | Coenzyme Q10-d6 is deuterium labeled Coenzyme Q10. Coenzyme Q10 is an essential cofactor of the electron transport chain and a potent antioxidant agent. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 869.0±65.0 °C at 760 mmHg |
| Molecular Formula | C59H84D6O4 |
| Molecular Weight | 869.38 |
| Flash Point | 324.6±34.3 °C |
| Exact Mass | 868.721558 |
| LogP | 20.93 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | ACTIUHUUMQJHFO-YDQRCUKRSA-N |
| SMILES | COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)=C(C)C1=O |
| 2,5-Cyclohexadiene-1,4-dione, 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaen-1-yl]-3-methyl-5,6-bis(methyl-d3-oxy)- |
| 2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,39-Decamethyl-2,6,10,14,18,22,26,30,34,38-tetracontadecaen-1-yl]-3-methyl-5,6-bis[(2H3)methyloxy]-1,4-benzoquinone |
| coenzyme q10-d6 |