BOT-64 structure
|
Common Name | BOT-64 | ||
|---|---|---|---|---|
| CAS Number | 113760-29-5 | Molecular Weight | 273.35 | |
| Density | 1.27±0.1 g/cm3 | Boiling Point | 402.1±48.0 °C | |
| Molecular Formula | C15H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BOT-64BOT-64 is an inhibitory κB (IκB) kinase β (IKKβ) inhibitor with an IC50 of 1 µM. BOT-64 blocks lipopolysaccharide-induced nuclear factor-κB activation and nuclear factor-κB-regulated inflammatory gene transcription[1]. |
| Name | 6,6-dimethyl-2-phenylimino-5,7-dihydro-1,3-benzoxathiol-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | BOT-64 is an inhibitory κB (IκB) kinase β (IKKβ) inhibitor with an IC50 of 1 µM. BOT-64 blocks lipopolysaccharide-induced nuclear factor-κB activation and nuclear factor-κB-regulated inflammatory gene transcription[1]. |
|---|---|
| Related Catalog | |
| Target |
IKKβ:1 μM (IC50) |
| In Vivo | BOT-64 (3-30 mg/kg) increases the survival rates of endotoxin LPS-shocked mice[1]. |
| References |
| Density | 1.27±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.1±48.0 °C |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.35 |
| Exact Mass | 273.08200 |
| PSA | 70.81000 |
| LogP | 3.72860 |
| InChIKey | XFSSJIQCIPSBHJ-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2sc(=Nc3ccccc3)oc2C1 |
| Storage condition | 20°C |
| 6,6-dimethyl-2-(phenylimino)-6,7-dihydro-5H-benzo[1,3]oxathiol-4-one |
| 1,3-Benzoxathiol-4(5H)-one,6,7-dihydro-6,6-dimethyl-2-(phenylimino) |
| 2-phenylimino-4-oxo-4,5,6,7-tetrahydro-6,6-dimethyl-1,3-benzoxathiole |
| 6,6-dimethyl-2-(phenylimino)-6,7-dihydrobenzo[d][1,3]oxathiol-4(5H)-one |