Benzyl-PEG8-Ots structure
|
Common Name | Benzyl-PEG8-Ots | ||
|---|---|---|---|---|
| CAS Number | 1144113-17-6 | Molecular Weight | 614.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H46O11S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Benzyl-PEG8-OtsBenzyl-PEG8-Ots is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | Benzyl-PEG8-Ots |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-PEG8-Ots is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Molecular Formula | C30H46O11S |
|---|---|
| Molecular Weight | 614.74 |
| InChIKey | JZRYNAITFJTHLY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCc2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|
| MFCD31656956 |