Benzyl-PEG8-THP structure
|
Common Name | Benzyl-PEG8-THP | ||
|---|---|---|---|---|
| CAS Number | 1611489-00-9 | Molecular Weight | 544.675 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 602.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C28H48O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1±31.4 °C | |
Use of Benzyl-PEG8-THPBenzyl-PEG8-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[(1-Phenyl-2,5,8,11,14,17,20,23-octaoxapentacosan-25-yl)oxy]tetrahydro-2H-pyran |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-PEG8-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.0±55.0 °C at 760 mmHg |
| Molecular Formula | C28H48O10 |
| Molecular Weight | 544.675 |
| Flash Point | 224.1±31.4 °C |
| Exact Mass | 544.324768 |
| LogP | -0.48 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | XXTUFBIHDZCEJS-UHFFFAOYSA-N |
| SMILES | c1ccc(COCCOCCOCCOCCOCCOCCOCCOCCOC2CCCCO2)cc1 |
| MFCD29049395 |
| 2-[(1-Phenyl-2,5,8,11,14,17,20,23-octaoxapentacosan-25-yl)oxy]tetrahydro-2H-pyran |
| 2H-Pyran, tetrahydro-2-[(25-phenyl-3,6,9,12,15,18,21,24-octaoxapentacos-1-yl)oxy]- |
| Benzyl-PEG8-THP |