Boeravinone B structure
|
Common Name | Boeravinone B | ||
|---|---|---|---|---|
| CAS Number | 114567-34-9 | Molecular Weight | 312.274 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 640.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H12O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 244.3±25.0 °C | |
Use of Boeravinone BBoeravinone B, a dual inhibitor of NorA bacterial efflux pump of Staphylococcus aureus and human P-Glycoprotein, reduces the biofilm formation and intracellular invasion of bacteria. Boeravinone B act as anti-aging and anti-apoptosis phyto-molecules during oxidative stress[1][2]. |
| Name | Boeravinone B |
|---|---|
| Synonym | More Synonyms |
| Description | Boeravinone B, a dual inhibitor of NorA bacterial efflux pump of Staphylococcus aureus and human P-Glycoprotein, reduces the biofilm formation and intracellular invasion of bacteria. Boeravinone B act as anti-aging and anti-apoptosis phyto-molecules during oxidative stress[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Boeravinone B is also active against a methicillin-resistant S. aureus (MRSA) strain, which showed a fourfold reduction in the ciprofloxacin MIC[1]. |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 640.1±55.0 °C at 760 mmHg |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.274 |
| Flash Point | 244.3±25.0 °C |
| Exact Mass | 312.063385 |
| PSA | 100.13000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.772 |
| InChIKey | YVVDYYFGAWQOGB-UHFFFAOYSA-N |
| SMILES | Cc1c(O)cc2oc3c(c(=O)c2c1O)-c1ccccc1OC3O |
| Hazard Codes | N |
|---|---|
| RIDADR | NONH for all modes of transport |
| 6,9,11-Trihydroxy-10-methyl-[1]benzopyrano[3,4-b][1]benzopyran-12(6H)-one |
| [1]Benzopyrano[3,4-b][1]benzopyran-12(6H)-one, 6,9,11-trihydroxy-10-methyl- |
| 6,9,11-Trihydroxy-10-methylchromeno[3,4-b]chromen-12(6H)-one |