CB-7921220 structure
|
Common Name | CB-7921220 | ||
|---|---|---|---|---|
| CAS Number | 115453-99-1 | Molecular Weight | 240.261 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2 | Melting Point | 225 - 226 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of CB-7921220CB-7921220 is an adenylate cyclase inhibitor. |
| Name | CB7921220 |
|---|---|
| Synonym | More Synonyms |
| Description | CB-7921220 is an adenylate cyclase inhibitor. |
|---|---|
| Related Catalog | |
| In Vitro | CB-7921220 shows a degree of isoform selectivity for adenylate cyclase (AC) 1, but cannot distinguish between AC1 and AC6. CB-7921220 has a more consistent predicted binding position in the two virtual docking screens, and has a binding conformation similar to ATP and P-site inhibitors, which may explain its lack of selectivity between AC1 and AC6[1]. |
| References |
| Melting Point | 225 - 226 °C |
|---|---|
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.261 |
| InChIKey | QASPDWZDKLUOPO-RMKNXTFCSA-N |
| SMILES | Nc1ccc(C=Cc2cccc(C(=O)O)n2)cc1 |
| Storage condition | 2-8℃ |
| 6-[2-(4-aminophenyl)vinyl]-2-pyridinecarboxylic acid |
| CB-7921220 |