BOC-L-Phenylglycinol structure
|
Common Name | BOC-L-Phenylglycinol | ||
|---|---|---|---|---|
| CAS Number | 117049-14-6 | Molecular Weight | 237.295 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 382.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C13H19NO3 | Melting Point | 136-140ºC | |
| MSDS | USA | Flash Point | 185.0±25.9 °C | |
| Name | (S)-2-(Tert-Butoxycarbonylamino)-2-Phenylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.4±35.0 °C at 760 mmHg |
| Melting Point | 136-140ºC |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.295 |
| Flash Point | 185.0±25.9 °C |
| Exact Mass | 237.136490 |
| PSA | 58.56000 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | IBDIOGYTZBKRGI-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)c1ccccc1 |
| Hazard Codes | C |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~0%
BOC-L-Phenylglycinol CAS#:117049-14-6 |
| Literature: List, Benjamin; Pojarliev, Peter; Biller, William T.; Martin, Harry J. Journal of the American Chemical Society, 2002 , vol. 124, # 5 p. 827 - 833 |
|
~%
BOC-L-Phenylglycinol CAS#:117049-14-6 |
| Literature: Synthesis, , # 2 p. 181 - 186 |
|
~%
BOC-L-Phenylglycinol CAS#:117049-14-6
Detail
|
| Literature: Journal of the Chemical Society - Perkin Transactions 1, , # 16 p. 2519 - 2526 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-tert-Butyl (2-hydroxy-1-phenylethyl)carbamate |
| N-Boc-L-phenylglycinol |
| MFCD00274206 |
| N-(tert-Butoxycarbonyl)-L-2-phenylglycinol |
| tert-Butyl [(1S)-2-hydroxy-1-phenylethyl]carbamate |
| BOC-L-Phenylglycinol |
| (S)-2-(tert-Butoxycarbonylamino)-2-phenylethanol |
| tert-butyl N-[(1S)-2-hydroxy-1-phenylethyl]carbamate |
| N-Boc-L-2-phenylglycinol |
| 2-Methyl-2-propanyl [(1S)-2-hydroxy-1-phenylethyl]carbamate |
| Carbamic acid, N-[(1S)-2-hydroxy-1-phenylethyl]-, 1,1-dimethylethyl ester |
| Boc-phenylglycinol |