N-Fmoc-1-amino-1-cyclopentanecarboxylic acid structure
|
Common Name | N-Fmoc-1-amino-1-cyclopentanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 117322-30-2 | Molecular Weight | 351.396 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 579.4±29.0 °C at 760 mmHg | |
| Molecular Formula | C21H21NO4 | Melting Point | 187 °C(dec.) | |
| MSDS | USA | Flash Point | 304.2±24.3 °C | |
| Name | Fmoc-1-aminocyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 579.4±29.0 °C at 760 mmHg |
| Melting Point | 187 °C(dec.) |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.396 |
| Flash Point | 304.2±24.3 °C |
| Exact Mass | 351.147064 |
| PSA | 75.63000 |
| LogP | 4.17 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | IECZEINPZOFWNU-UHFFFAOYSA-N |
| SMILES | O=C(NC1(C(=O)O)CCCC1)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~33%
N-Fmoc-1-amino-... CAS#:117322-30-2 |
| Literature: Zych, Andrew J.; Iverson, Brent L. Journal of the American Chemical Society, 2000 , vol. 122, # 37 p. 8898 - 8909 |
|
~70%
N-Fmoc-1-amino-... CAS#:117322-30-2 |
| Literature: Babu, Vommina V. Suresh; Ananda, Kuppanna Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 2001 , vol. 40, # 1 p. 70 - 74 |
|
~%
N-Fmoc-1-amino-... CAS#:117322-30-2 |
| Literature: Tetrahedron Letters, , vol. 44, # 46 p. 8403 - 8406 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Fmoc-1-amino-1-cyclopentanecarboxylic acid |
| 1-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanecarboxylic Acid |
| Fmoc-cycloleucine |
| Cyclopentanecarboxylic acid, 1-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]- |
| 1-(Fmoc-amino)cyclopentanecarboxylic acid |
| 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| MFCD01074696 |
| 1-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}cyclopentanecarboxylic acid |
| FMOC-AC5C-OH |