Guanosine structure
|
Common Name | Guanosine | ||
|---|---|---|---|---|
| CAS Number | 118-00-3 | Molecular Weight | 283.241 | |
| Density | 2.3±0.1 g/cm3 | Boiling Point | 756.6±70.0 °C at 760 mmHg | |
| Molecular Formula | C10H13N5O5 | Melting Point | 240ºC | |
| MSDS | Chinese USA | Flash Point | 411.4±35.7 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of GuanosineGuanosine is a purine nucleoside comprising guanine attached to a ribose (ribofuranose) ring via a β-N9-glycosidic bond. |
| Name | guanosine |
|---|---|
| Synonym | More Synonyms |
| Description | Guanosine is a purine nucleoside comprising guanine attached to a ribose (ribofuranose) ring via a β-N9-glycosidic bond. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Guanosine can be phosphorylated to become guanosine monophosphate (GMP), cyclic guanosine monophosphate (cGMP), guanosine diphosphate (GDP), and guanosine triphosphate (GTP). These forms play important roles in various biochemical processes such as synthesis of nucleic acids and proteins, photosynthesis, muscle contraction, and intracellular signal transduction (cGMP). |
| Density | 2.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 756.6±70.0 °C at 760 mmHg |
| Melting Point | 240ºC |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.241 |
| Flash Point | 411.4±35.7 °C |
| Exact Mass | 283.091675 |
| PSA | 159.51000 |
| LogP | -3.27 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.955 |
| InChIKey | NYHBQMYGNKIUIF-UUOKFMHZSA-N |
| SMILES | Nc1nc2c(ncn2C2OC(CO)C(O)C2O)c(=O)[nH]1 |
| Storage condition | 2~8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | R25 |
| Safety Phrases | S24/25 |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MF8750000 |
| Hazard Class | 6.1 |
| HS Code | 29349990 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Insights from reconstitution reactions of COPII vesicle formation using pure components and low mechanical perturbation.
Biol. Chem. 395(7-8) , 801-12, (2014) As shape transformations of membranes are vital for intracellular trafficking, it is crucial to understand both the mechanics and the biochemistry of these processes. The interplay of these two factor... |
|
|
Hairpin assembly circuit-based fluorescence cooperative amplification strategy for enzyme-free and label-free detection of small molecule.
Talanta 143 , 101-6, (2015) Here, we developed an enzyme-free, label-free, and sensitive fluorescence cooperative amplification strategy based on a hairpin assembly circuit which coupled catalytic hairpin assembly (CHA) with hyb... |
|
|
Brexpiprazole I: in vitro and in vivo characterization of a novel serotonin-dopamine activity modulator.
J. Pharmacol. Exp. Ther. 350(3) , 589-604, (2014) Brexpiprazole (OPC-34712, 7-{4-[4-(1-benzothiophen-4-yl)piperazin-1-yl]butoxy}quinolin-2(1H)-one) is a novel drug candidate in clinical development for psychiatric disorders with high affinity for ser... |
| 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| 2-Amino-9-(β-D-ribofuranosyl)-3,9-dihydro-6H-purin-6-on |
| MFCD00010182 |
| 2-amino-Inosine |
| Guanosine |
| 2-Amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydro-2-furanyl]-1,9-dihydro-6H-purin-6-one |
| 6H-Purin-6-one, 2-amino-1,9-dihydro-9-β-D-ribofuranosyl- |
| 9-(β-D-Ribofuranosyl)guanine |
| guanine riboside |
| Inosine,2-amino |
| 2-Amino-1,9-dihydro-9-β-D-ribofuranosyl-6H-purin-6-one |
| 2-Amino-9-(β-D-ribofuranosyl)-9H-purin-6-ol |
| EINECS 204-227-8 |
| 9-β-D-ribofuranosyl-Guanine |
| 2-Amino-9-(β-D-ribofuranosyl)-1,9-dihydro-6H-purin-6-on |
| vernine |
| 2H-purin-6-ol, 3,9-dihydro-2-imino-9-β-D-ribofuranosyl- |
| USAF CB-11 |
| Guanine-9-β-D-ribofuranoside |
| Guanosin |
| Guanosine Hydrate |
| Guanine, 9-β-D-ribofuranosyl- |
| 2-Amino-9-β-D-ribofuranosyl-9H-purine-6(1H)-one |
| 9-β-D-ribofuranosylguanine |
| 9H-purin-6-ol, 2-amino-9-β-D-ribofuranosyl- |
| 2-Amino-9-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-purin-6(9H)-one |
| Guanozin |