Hydrastine structure
|
Common Name | Hydrastine | ||
|---|---|---|---|---|
| CAS Number | 118-08-1 | Molecular Weight | 383.39500 | |
| Density | 1.339g/cm3 | Boiling Point | 548.8ºC at 760mmHg | |
| Molecular Formula | C21H21NO6 | Melting Point | 132ºC | |
| MSDS | N/A | Flash Point | 285.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of HydrastineHydrastine is a natural alkaloid which is present in Hydrastis canadensis and other plants of the ranunculaceae family. |
| Name | (-)-β-HYDRASTINE |
|---|---|
| Synonym | More Synonyms |
| Description | Hydrastine is a natural alkaloid which is present in Hydrastis canadensis and other plants of the ranunculaceae family. |
|---|---|
| Related Catalog |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 548.8ºC at 760mmHg |
| Melting Point | 132ºC |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.39500 |
| Flash Point | 285.7ºC |
| Exact Mass | 383.13700 |
| PSA | 66.46000 |
| LogP | 2.81110 |
| Vapour Pressure | 4.28E-12mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | JZUTXVTYJDCMDU-MOPGFXCFSA-N |
| SMILES | COc1ccc2c(c1OC)C(=O)OC2C1c2cc3c(cc2CCN1C)OCO3 |
| Storage condition | −20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332 |
| Precautionary Statements | P261-P280-P301 + P312 + P330 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22 |
| Safety Phrases | S36 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | MU6030000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~67%
Hydrastine CAS#:118-08-1 |
| Literature: Kerekes; Gaal Gy.; Bognar Acta Chimica Academiae Scientiarum Hungaricae, 1980 , vol. 103, # 4 p. 339 - 341 |
|
~71%
Hydrastine CAS#:118-08-1 |
| Literature: Zelle; McClellan Tetrahedron Letters, 1991 , vol. 32, # 22 p. 2461 - 2464 |
|
~%
Hydrastine CAS#:118-08-1 |
| Literature: Acta Chimica Academiae Scientiarum Hungaricae, , vol. 103, # 4 p. 339 - 341 |
|
~%
Hydrastine CAS#:118-08-1 |
| Literature: Journal of Organic Chemistry, , vol. 37, p. 1879 - 1881 |
|
~%
Hydrastine CAS#:118-08-1 |
| Literature: Journal of the Chemical Society, , p. 1776,1779 |
| Precursor 7 | |
|---|---|
| DownStream 7 | |
| Hydrastine (10 mg) |
| quinolin-5-yl) |
| HYDRASTINE |
| Hydrastinebase |
| (-)-Beta-Hydrastine |
| EINECS 204-233-0 |
| MFCD00152561 |
| (-)-B-HYDIASTINE |
| l-hydrastine |
| HYDRASTINE,(-)-B |