crotmadine structure
|
Common Name | crotmadine | ||
|---|---|---|---|---|
| CAS Number | 118266-99-2 | Molecular Weight | 324.37 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 549.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H20O4 | Melting Point | 239-240℃ | |
| MSDS | N/A | Flash Point | 198.7±23.6 °C | |
Use of crotmadineIsodorsmanin A is an anti-inflammatory agent. Isodorsmanin A suppresses the production of inflammatory mediators and proinflammatory cytokines. Isodorsmanin A inhibits the phosphorylation of JNK, MAPK[1]. |
| Name | Isodorsmanin A |
|---|---|
| Synonym | More Synonyms |
| Description | Isodorsmanin A is an anti-inflammatory agent. Isodorsmanin A suppresses the production of inflammatory mediators and proinflammatory cytokines. Isodorsmanin A inhibits the phosphorylation of JNK, MAPK[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 549.9±50.0 °C at 760 mmHg |
| Melting Point | 239-240℃ |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.37 |
| Flash Point | 198.7±23.6 °C |
| Exact Mass | 324.136169 |
| PSA | 66.76000 |
| LogP | 4.75 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | SEDVPKQZRCGYNR-WEVVVXLNSA-N |
| SMILES | CC1(C)CCc2c(O)ccc(C(=O)C=Cc3ccc(O)cc3)c2O1 |
| Hazard Codes | Xi |
|---|
| (2E)-1-(5-hydroxy-2,2-dimethyl-3,4-dihydro-2H-chromen-8-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| 2-Propen-1-one, 1-(3,4-dihydro-5-hydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl)-3-(4-hydroxyphenyl)-, (2E)- |
| (2E)-1-(5-Hydroxy-2,2-dimethyl-3,4-dihydro-2H-chromen-8-yl)-3-(4-hydroxyphenyl)-2-propen-1-one |
| crotmadine |