VISTA inhibitor M351-056 structure
|
Common Name | VISTA inhibitor M351-056 | ||
|---|---|---|---|---|
| CAS Number | 1189495-81-5 | Molecular Weight | 447.355 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12BrFN2O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VISTA inhibitor M351-056VISTA inhibitor M351-056 is a small molecule compound having affinity with VISTA. |
| Name | VISTA inhibitor M351-056 |
|---|
| Description | VISTA inhibitor M351-056 is a small molecule compound having affinity with VISTA. |
|---|---|
| References | 1. Patent CN108743590, Small molecule compound having affinity with VISTA and use thereof. |
| Molecular Formula | C15H12BrFN2O2S3 |
|---|---|
| Molecular Weight | 447.355 |
| InChIKey | VWQLSIBNGFNHPL-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cc(S(=O)(=O)Nc3ccc(Br)cc3F)c(C)s2)cs1 |