4'-Hydroxy diclofenac-13C6 structure
|
Common Name | 4'-Hydroxy diclofenac-13C6 | ||
|---|---|---|---|---|
| CAS Number | 1189656-64-1 | Molecular Weight | 318.10400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 48.2 °F | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
Use of 4'-Hydroxy diclofenac-13C64'-Hydroxy diclofenac-13C6 is the 13C labeled 4'-Hydroxy diclofenac[1]. 4'-Hydroxy diclofenac is an orally active metabolite of Diclofenac (HY-15036) by cytochrome P450 2C9 (CYP2C9). 4'-Hydroxy diclofenac has anti-inflammatory and analgesic properties[2][3]. |
| Name | 2-[2-(2,6-dichloro-4-hydroxyanilino)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 4'-Hydroxy diclofenac-13C6 is the 13C labeled 4'-Hydroxy diclofenac[1]. 4'-Hydroxy diclofenac is an orally active metabolite of Diclofenac (HY-15036) by cytochrome P450 2C9 (CYP2C9). 4'-Hydroxy diclofenac has anti-inflammatory and analgesic properties[2][3]. |
|---|---|
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C14H11Cl2NO3 |
|---|---|
| Molecular Weight | 318.10400 |
| Exact Mass | 317.03200 |
| PSA | 69.56000 |
| LogP | 4.14270 |
| InChIKey | KGVXVPRLBMWZLG-OLWCKNASSA-N |
| SMILES | O=C(O)Cc1ccccc1Nc1c(Cl)cc(O)cc1Cl |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| Flash Point(F) | 48.2 °F |
| Flash Point(C) | 9 °C |
| 4'-Hydroxy Diclofenac-13C6 |