benzethonium chloride structure
|
Common Name | benzethonium chloride | ||
|---|---|---|---|---|
| CAS Number | 121-54-0 | Molecular Weight | 448.081 | |
| Density | 0.998 g/mL at 20 °C | Boiling Point | N/A | |
| Molecular Formula | C27H42ClNO2 | Melting Point | 162-164 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS06, GHS09 |
Signal Word | Danger | |
Use of benzethonium chlorideBenzethonium chloride inhibit human recombinant α7 and α4β2 neuronal nicotinic acetylcholine receptors in Xenopus oocytes. |
| Name | benzethonium chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Benzethonium chloride inhibit human recombinant α7 and α4β2 neuronal nicotinic acetylcholine receptors in Xenopus oocytes. |
|---|---|
| Related Catalog |
| Density | 0.998 g/mL at 20 °C |
|---|---|
| Melting Point | 162-164 °C(lit.) |
| Molecular Formula | C27H42ClNO2 |
| Molecular Weight | 448.081 |
| Exact Mass | 447.290405 |
| PSA | 18.46000 |
| LogP | 6.87440 |
| InChIKey | UREZNYTWGJKWBI-UHFFFAOYSA-M |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1.[Cl-] |
| Stability | Stability Stable, but hygroscopic. Incompatible with strong oxidizing agents, soap, anionic detergents, nitrates, acids. Light sensitive. |
| Water Solubility | 1-5 g/100 mL at 18 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H314-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P310-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22;R36 |
| Safety Phrases | S26-S36/39-S24/25 |
| RIDADR | UN1759 |
| WGK Germany | 2 |
| RTECS | BO7175000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2942000000 |
|
~%
benzethonium ch... CAS#:121-54-0 |
| Literature: US2170111 , ; |
|
~%
benzethonium ch... CAS#:121-54-0 |
| Literature: US2170111 , ; |
|
~%
benzethonium ch... CAS#:121-54-0 |
| Literature: US2170111 , ; |
|
~%
benzethonium ch... CAS#:121-54-0 |
| Literature: Canadian Journal of Chemistry, , vol. 69, # 6 p. 937 - 944 |
|
~%
benzethonium ch... CAS#:121-54-0 |
| Literature: Canadian Journal of Chemistry, , vol. 69, # 6 p. 937 - 944 |
| HS Code | 2942000000 |
|---|
|
Cytokine pathway disruption in a mouse model of schizophrenia induced by Munc18-1a overexpression in the brain.
J. Neuroinflammation 11 , 128, (2014) An accumulating body of evidence points to the significance of neuroinflammation and immunogenetics in schizophrenia, and an imbalance of cytokines in the central nervous system (CNS) has been suggest... |
|
|
Interactive actions of Bdnf methylation and cell metabolism for building neural resilience under the influence of diet.
Neurobiol. Dis. 73 , 307-18, (2014) Quality nutrition during the period of brain formation is a predictor of brain functional capacity and plasticity during adulthood; however it is not clear how this conferred plasticity imparts long-t... |
|
|
Fluoroquinolone efflux by the plasmid-mediated multidrug efflux pump QacB variant QacBIII in Staphylococcus aureus.
Antimicrob. Agents Chemother. 54 , 4107-11, (2010) Plasmids that carry the multidrug efflux genes qacA and qacB are widely distributed in methicillin-resistant Staphylococcus aureus (MRSA). Although the QacA and QacB proteins are similar to each other... |
| SOLAMIN |
| N-Benzyl-N,N-dimethyl-2-{2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy}ethanaminium chloride |
| benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride |
| Benzenemethanaminium, N,N-dimethyl-N-(2-(2-(4-(1,1,3,3-tetramethylbutyl)phenoxy)ethoxy)ethyl)-, chloride |
| inactisol |
| (Diisobutylphenoxyethoxyethyl)dimethylbenzylammonium chloride,Phemerol chloride |
| diapp |
| phemerol Chloride |
| benzetonium chloride |
| N,N-Dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]benzenemethanaminium Chloride |
| N-benzyl-N,N-dimethyl-2-{2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy}ethanaminium chloride |
| Benzethonium Chloride (500 mg) |
| sanizol |
| Benzethoniumchloride |
| HYAMINE 1622, REAG |
| banagerm |
| benzethonium chloride |
| benzyldimethyl(2-{2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy}ethyl)azanium chloride |
| EINECS 204-479-9 |
| disilyn |
| Hyamine1622 |
| diisobutylphenoxyethoxyethyl dimethyl benzyl ammonium chloride |
| phemithyn |
| MFCD00011742 |
| Benzenemethanaminium, N,N-dimethyl-N-[2-[2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy]ethyl]-, chloride (1:1) |
| (Diisobutylphenoxyethoxyethyl)dimethylbenzylammonium chloride |
| Benzyldimethyl[2-[2-(p-1,1,3,3-tetramethylbutylphenoxy)ethoxy]ethyl]ammonium Chloride |
| solamine |
| N-Benzyl-N,N-dimethyl-2-{2-[4-(2,4,4-trimethyl-2-pentanyl)phenoxy]ethoxy}ethanaminium chloride |
| HYAMINE |
| BENZETHONIUM CHLORIDE, EP STANDARD |