Repaglinide D5 structure
|
Common Name | Repaglinide D5 | ||
|---|---|---|---|---|
| CAS Number | 1217709-85-7 | Molecular Weight | 457.61700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H31D5N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Repaglinide D5Repaglinide D5 (AG-EE 623ZW D5) is deuterium labeled Repaglinide. Repaglinide is an insulin secretagogue for the treatment of type-2 diabetes mellitus[1]. |
| Name | 4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]-2-(1,1,2,2,2-pentadeuterioethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Repaglinide D5 (AG-EE 623ZW D5) is deuterium labeled Repaglinide. Repaglinide is an insulin secretagogue for the treatment of type-2 diabetes mellitus[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Repaglinide reduces postprandial glucose levels by enhancing the early phase of insulin secretion and increasing the total amount of insulin secreted[1]. |
| References |
| Molecular Formula | C27H31D5N2O4 |
|---|---|
| Molecular Weight | 457.61700 |
| Exact Mass | 457.29900 |
| PSA | 82.36000 |
| LogP | 6.12520 |
| InChIKey | FAEKWTJYAYMJKF-NTSVIFQKSA-N |
| SMILES | CCOc1cc(CC(=O)NC(CC(C)C)c2ccccc2N2CCCCC2)ccc1C(=O)O |
| Storage condition | -20°C |
| [2H5]-Repaglinide |
| Repaglinide-ethyl-d5 |