Fenoldopam-d4 mesylate structure
|
Common Name | Fenoldopam-d4 mesylate | ||
|---|---|---|---|---|
| CAS Number | 1246815-23-5 | Molecular Weight | 405.89 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16D4ClNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fenoldopam-d4 mesylateFenoldopam-d4 (SKF-82526-d4) mesylate is the deuterium labeled Fenoldopam mesylate. Fenoldopam (SKF 82526) mesylate is a drug and synthetic benzazepine derivative which acts as a selective D1 receptor partial agonist[1][2]. |
| Name | Fenoldopam-d4 mesylate |
|---|
| Description | Fenoldopam-d4 (SKF-82526-d4) mesylate is the deuterium labeled Fenoldopam mesylate. Fenoldopam (SKF 82526) mesylate is a drug and synthetic benzazepine derivative which acts as a selective D1 receptor partial agonist[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C17H16D4ClNO6S |
|---|---|
| Molecular Weight | 405.89 |
| InChIKey | CVKUMNRCIJMVAR-ZHTTVBFJSA-N |
| SMILES | CS(=O)(=O)O.Oc1ccc(C2CNCCc3c2cc(O)c(O)c3Cl)cc1 |