Diphenolic acid structure
|
Common Name | Diphenolic acid | ||
|---|---|---|---|---|
| CAS Number | 126-00-1 | Molecular Weight | 286.322 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 507.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | 167-170 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 274.5±23.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Diphenolic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 507.0±40.0 °C at 760 mmHg |
| Melting Point | 167-170 °C(lit.) |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.322 |
| Flash Point | 274.5±23.8 °C |
| Exact Mass | 286.120514 |
| PSA | 77.76000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | VKOUCJUTMGHNOR-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)O)(c1ccc(O)cc1)c1ccc(O)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | S26-S37/39-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918290000 |
|
~%
Diphenolic acid CAS#:126-00-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 43, # 17 p. 3322 - 3334 |
|
~%
Diphenolic acid CAS#:126-00-1 |
| Literature: Journal of the American Chemical Society, , vol. 76, p. 4465 |
|
~%
Diphenolic acid CAS#:126-00-1 |
| Literature: Chemical Communications, , vol. 48, # 29 p. 3497 - 3499 |
|
~%
Diphenolic acid CAS#:126-00-1 |
| Literature: Green Chemistry, , vol. 15, # 1 p. 81 - 84 |
|
~%
Diphenolic acid CAS#:126-00-1 |
| Literature: Green Chemistry, , vol. 15, # 1 p. 81 - 84 |
|
~%
Diphenolic acid CAS#:126-00-1 |
| Literature: Green Chemistry, , vol. 15, # 1 p. 81 - 84 |
|
~%
Diphenolic acid CAS#:126-00-1 |
| Literature: Journal of the American Chemical Society, , vol. 76, p. 4465 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Diphenolic acid |
| EINECS 204-763-2 |
| 4,4-Bis(4-hydroxyphenyl)pentanoic acid |
| MFCD00002800 |
| 4,4-bis(4-hydroxyphenyl)valeric acid |
| 4,4-BIS(PARA-HYDROXYPHENYL)VALERIC ACID |
| Benzenebutanoic acid, 4-hydroxy-γ-(4-hydroxyphenyl)-γ-methyl- |
| 4,4-Bis(p-hydroxyphenyl)valeric acid |